C70H30F27N3 — CID 146238208
3-[2,6-bis[3,6-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 146238208) has the molecular formula C70H30F27N3 and a molecular weight of 1425.98 g/mol. Its IUPAC name is 3-[2,6-bis[3,6-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[2,6-bis[3,6-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 146238208 |
| Molecular Formula | C70H30F27N3 |
| Molecular Weight | 1425.98 g/mol |
| Exact Mass | 1425.20 |
| IUPAC Name | 3-[2,6-bis[3,6-bis[2,4-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2c(-n3c4ccc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)cc4c4cc(-c5ccc(C(F)(F)F)cc5C(F)(F)F)ccc43)cc(C(F)(F)F)cc2-n2c3ccc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)cc3c3cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C70H30F27N3/c71-62(72,73)38-8-12-43(51(25-38)67(86,87)88)33-4-16-55-47(21-33)48-22-34(44-13-9-39(63(74,75)76)26-52(44)68(89,90)91)5-17-56(48)99(55)59-29-42(66(83,84)85)30-60(61(59)37-3-1-2-32(20-37)31-98)100-57-18-6-35(45-14-10-40(64(77,78)79)27-53(45)69(92,93)94)23-49(57)50-24-36(7-19-58(50)100)46-15-11-41(65(80,81)82)28-54(46)70(95,96)97/h1-30H |
| InChIKey | NNWOQHZFVNVPFC-UHFFFAOYSA-N |
| XLogP | 25.26 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 100 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1425.98 |
| LogP ≤ 5 | 25.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |