C66H45F4N3 — CID 168764759
3,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-4-[2-fluoro-6-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 168764759) has the molecular formula C66H45F4N3 and a molecular weight of 956.10 g/mol. Its IUPAC name is 3,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-4-[2-fluoro-6-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-4-[2-fluoro-6-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 168764759 |
| Molecular Formula | C66H45F4N3 |
| Molecular Weight | 956.10 g/mol |
| Exact Mass | 955.35 |
| IUPAC Name | 3,5-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-4-[2-fluoro-6-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1ccc(-c2ccc3c4ccc(-c5ccc(C)cc5)cc4n(-c4cc(C#N)cc(-n5c6cc(-c7ccc(C)cc7)ccc6c6ccc(-c7ccc(C)cc7)cc65)c4-c4c(F)cccc4C(F)(F)F)c3c2)cc1 |
| InChI | InChI=1S/C66H45F4N3/c1-39-8-16-44(17-9-39)48-24-28-52-53-29-25-49(45-18-10-40(2)11-19-45)35-59(53)72(58(52)34-48)62-32-43(38-71)33-63(65(62)64-56(66(68,69)70)6-5-7-57(64)67)73-60-36-50(46-20-12-41(3)13-21-46)26-30-54(60)55-31-27-51(37-61(55)73)47-22-14-42(4)15-23-47/h5-37H,1-4H3 |
| InChIKey | TWDFTLIBGCCCNV-UHFFFAOYSA-N |
| XLogP | 18.48 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.10 |
| LogP ≤ 5 | 18.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |