C66H46F3N3 — CID 146238220
3-[2,6-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 146238220) has the molecular formula C66H46F3N3 and a molecular weight of 938.11 g/mol. Its IUPAC name is 3-[2,6-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[2,6-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 146238220 |
| Molecular Formula | C66H46F3N3 |
| Molecular Weight | 938.11 g/mol |
| Exact Mass | 937.36 |
| IUPAC Name | 3-[2,6-bis[2,7-bis(4-methylphenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1ccc(-c2ccc3c4ccc(-c5ccc(C)cc5)cc4n(-c4cc(C(F)(F)F)cc(-n5c6cc(-c7ccc(C)cc7)ccc6c6ccc(-c7ccc(C)cc7)cc65)c4-c4cccc(C#N)c4)c3c2)cc1 |
| InChI | InChI=1S/C66H46F3N3/c1-40-8-16-45(17-9-40)49-24-28-55-56-29-25-50(46-18-10-41(2)11-19-46)34-60(56)71(59(55)33-49)63-37-54(66(67,68)69)38-64(65(63)53-7-5-6-44(32-53)39-70)72-61-35-51(47-20-12-42(3)13-21-47)26-30-57(61)58-31-27-52(36-62(58)72)48-22-14-43(4)15-23-48/h5-38H,1-4H3 |
| InChIKey | GQFVUAFJQYMPDQ-UHFFFAOYSA-N |
| XLogP | 18.34 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.11 |
| LogP ≤ 5 | 18.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |