C70H54F3N3 — CID 155377888
3-[4,5-bis[2,7-bis(3,5-dimethylphenyl)carbazol-9-yl]-2-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 155377888) has the molecular formula C70H54F3N3 and a molecular weight of 994.22 g/mol. Its IUPAC name is 3-[4,5-bis[2,7-bis(3,5-dimethylphenyl)carbazol-9-yl]-2-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[4,5-bis[2,7-bis(3,5-dimethylphenyl)carbazol-9-yl]-2-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155377888 |
| Molecular Formula | C70H54F3N3 |
| Molecular Weight | 994.22 g/mol |
| Exact Mass | 993.43 |
| IUPAC Name | 3-[4,5-bis[2,7-bis(3,5-dimethylphenyl)carbazol-9-yl]-2-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1cc(C)cc(-c2ccc3c4ccc(-c5cc(C)cc(C)c5)cc4n(-c4cc(-c5cccc(C#N)c5)c(C(F)(F)F)cc4-n4c5cc(-c6cc(C)cc(C)c6)ccc5c5ccc(-c6cc(C)cc(C)c6)cc54)c3c2)c1 |
| InChI | InChI=1S/C70H54F3N3/c1-40-20-41(2)25-54(24-40)49-12-16-58-59-17-13-50(55-26-42(3)21-43(4)27-55)34-65(59)75(64(58)33-49)68-37-62(53-11-9-10-48(32-53)39-74)63(70(71,72)73)38-69(68)76-66-35-51(56-28-44(5)22-45(6)29-56)14-18-60(66)61-19-15-52(36-67(61)76)57-30-46(7)23-47(8)31-57/h9-38H,1-8H3 |
| InChIKey | PSAQEZKBLCOFJD-UHFFFAOYSA-N |
| XLogP | 19.57 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.22 |
| LogP ≤ 5 | 19.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |