C42H30F3N3 — CID 146238069
3-[2,6-bis(2,7-dimethylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 146238069) has the molecular formula C42H30F3N3 and a molecular weight of 633.72 g/mol. Its IUPAC name is 3-[2,6-bis(2,7-dimethylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[2,6-bis(2,7-dimethylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 146238069 |
| Molecular Formula | C42H30F3N3 |
| Molecular Weight | 633.72 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | 3-[2,6-bis(2,7-dimethylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1ccc2c3ccc(C)cc3n(-c3cc(C(F)(F)F)cc(-n4c5cc(C)ccc5c5ccc(C)cc54)c3-c3cccc(C#N)c3)c2c1 |
| InChI | InChI=1S/C42H30F3N3/c1-24-8-12-31-32-13-9-25(2)17-36(32)47(35(31)16-24)39-21-30(42(43,44)45)22-40(41(39)29-7-5-6-28(20-29)23-46)48-37-18-26(3)10-14-33(37)34-15-11-27(4)19-38(34)48/h5-22H,1-4H3 |
| InChIKey | DMSPLYVHKREGQA-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.72 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |