C53H27F6N5 — CID 134300624
4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[2-(3-cyanophenyl)carbazol-9-yl]benzonitrile (PubChem CID 134300624) has the molecular formula C53H27F6N5 and a molecular weight of 847.82 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[2-(3-cyanophenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[2-(3-cyanophenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 134300624 |
| Molecular Formula | C53H27F6N5 |
| Molecular Weight | 847.82 g/mol |
| Exact Mass | 847.22 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-3,5-bis[2-(3-cyanophenyl)carbazol-9-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3c4ccccc4n(-c4cc(C#N)cc(-n5c6ccccc6c6ccc(-c7cccc(C#N)c7)cc65)c4-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c3c2)c1 |
| InChI | InChI=1S/C53H27F6N5/c54-52(55,56)39-23-38(24-40(27-39)53(57,58)59)51-49(63-45-13-3-1-11-41(45)43-17-15-36(25-47(43)63)34-9-5-7-31(19-34)28-60)21-33(30-62)22-50(51)64-46-14-4-2-12-42(46)44-18-16-37(26-48(44)64)35-10-6-8-32(20-35)29-61/h1-27H |
| InChIKey | QKRWCNUXQZYACU-UHFFFAOYSA-N |
| XLogP | 14.53 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.82 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |