C52H34F3N3 — CID 137386429
3,5-bis[2-(4-methylphenyl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 137386429) has the molecular formula C52H34F3N3 and a molecular weight of 757.86 g/mol. Its IUPAC name is 3,5-bis[2-(4-methylphenyl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-bis[2-(4-methylphenyl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 137386429 |
| Molecular Formula | C52H34F3N3 |
| Molecular Weight | 757.86 g/mol |
| Exact Mass | 757.27 |
| IUPAC Name | 3,5-bis[2-(4-methylphenyl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1ccc(-c2ccc3c4ccccc4n(-c4cc(C#N)cc(-n5c6ccccc6c6ccc(-c7ccc(C)cc7)cc65)c4-c4ccccc4C(F)(F)F)c3c2)cc1 |
| InChI | InChI=1S/C52H34F3N3/c1-32-15-19-35(20-16-32)37-23-25-41-39-9-4-7-13-45(39)57(47(41)29-37)49-27-34(31-56)28-50(51(49)43-11-3-6-12-44(43)52(53,54)55)58-46-14-8-5-10-40(46)42-26-24-38(30-48(42)58)36-21-17-33(2)18-22-36/h3-30H,1-2H3 |
| InChIKey | LURHVVWDFGYSHS-UHFFFAOYSA-N |
| XLogP | 14.39 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.86 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |