C67H45F6N3 — CID 137392783
3,5-Bis[3,6-bis(4-methylphenyl)carbazol-9-yl]-4-[2,5-bis(trifluoromethyl)phenyl]benzonitrile (PubChem CID 137392783) has the molecular formula C67H45F6N3 and a molecular weight of 1006.10 g/mol. Its IUPAC name is 3,5-bis[3,6-bis(4-methylphenyl)carbazol-9-yl]-4-[2,5-bis(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-Bis[3,6-bis(4-methylphenyl)carbazol-9-yl]-4-[2,5-bis(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 137392783 |
| Molecular Formula | C67H45F6N3 |
| Molecular Weight | 1006.10 g/mol |
| Exact Mass | 1005.35 |
| IUPAC Name | 3,5-bis[3,6-bis(4-methylphenyl)carbazol-9-yl]-4-[2,5-bis(trifluoromethyl)phenyl]benzonitrile |
| SMILES | CC1=CC=C(C=C1)C2=CC3=C(C=C2)N(C4=C3C=C(C=C4)C5=CC=C(C=C5)C)C6=CC(=CC(=C6C7=C(C=CC(=C7)C(F)(F)F)C(F)(F)F)N8C9=C(C=C(C=C9)C1=CC=C(C=C1)C)C1=C8C=CC(=C1)C1=CC=C(C=C1)C)C#N |
| InChI | InChI=1S/C67H45F6N3/c1-39-5-13-44(14-6-39)48-21-27-59-53(33-48)54-34-49(45-15-7-40(2)8-16-45)22-28-60(54)75(59)63-31-43(38-74)32-64(65(63)57-37-52(66(68,69)70)25-26-58(57)67(71,72)73)76-61-29-23-50(46-17-9-41(3)10-18-46)35-55(61)56-36-51(24-30-62(56)76)47-19-11-42(4)12-20-47/h5-37H,1-4H3 |
| InChIKey | FCFZAMRZJLTRCG-UHFFFAOYSA-N |
| XLogP | 19.10 |
| TPSA | 33.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | 1770 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.10 |
| LogP ≤ 5 | 19.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |