C43H17F12N5 — CID 139538864
5-[2,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-cyanophenyl]benzene-1,3-dicarbonitrile (PubChem CID 139538864) has the molecular formula C43H17F12N5 and a molecular weight of 831.62 g/mol. Its IUPAC name is 5-[2,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-cyanophenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[2,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-cyanophenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139538864 |
| Molecular Formula | C43H17F12N5 |
| Molecular Weight | 831.62 g/mol |
| Exact Mass | 831.13 |
| IUPAC Name | 5-[2,6-bis[3,6-bis(trifluoromethyl)carbazol-9-yl]-4-cyanophenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2c(-n3c4ccc(C(F)(F)F)cc4c4cc(C(F)(F)F)ccc43)cc(C#N)cc2-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C43H17F12N5/c44-40(45,46)25-1-5-33-29(14-25)30-15-26(41(47,48)49)2-6-34(30)59(33)37-12-23(20-58)13-38(39(37)24-10-21(18-56)9-22(11-24)19-57)60-35-7-3-27(42(50,51)52)16-31(35)32-17-28(43(53,54)55)4-8-36(32)60/h1-17H |
| InChIKey | HKXKHUCURXRWRL-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.62 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |