C48H41F4N3 — CID 153484741
3,5-bis(3-tert-butyl-6-methylcarbazol-9-yl)-4-[2-fluoro-6-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 153484741) has the molecular formula C48H41F4N3 and a molecular weight of 735.87 g/mol. Its IUPAC name is 3,5-bis(3-tert-butyl-6-methylcarbazol-9-yl)-4-[2-fluoro-6-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3,5-bis(3-tert-butyl-6-methylcarbazol-9-yl)-4-[2-fluoro-6-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 153484741 |
| Molecular Formula | C48H41F4N3 |
| Molecular Weight | 735.87 g/mol |
| Exact Mass | 735.32 |
| IUPAC Name | 3,5-bis(3-tert-butyl-6-methylcarbazol-9-yl)-4-[2-fluoro-6-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(C#N)cc(-n2c3ccc(C)cc3c3cc(C(C)(C)C)ccc32)c1-c1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C48H41F4N3/c1-27-12-16-38-32(20-27)34-24-30(46(3,4)5)14-18-40(34)54(38)42-22-29(26-53)23-43(45(42)44-36(48(50,51)52)10-9-11-37(44)49)55-39-17-13-28(2)21-33(39)35-25-31(47(6,7)8)15-19-41(35)55/h9-25H,1-8H3 |
| InChIKey | QQXLUVXKDBDGRC-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.87 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |