C67H33N9 — CID 139538817
5-[2,6-bis[2,7-bis(2-cyanophenyl)carbazol-9-yl]-4-cyanophenyl]benzene-1,3-dicarbonitrile (PubChem CID 139538817) has the molecular formula C67H33N9 and a molecular weight of 964.06 g/mol. Its IUPAC name is 5-[2,6-bis[2,7-bis(2-cyanophenyl)carbazol-9-yl]-4-cyanophenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[2,6-bis[2,7-bis(2-cyanophenyl)carbazol-9-yl]-4-cyanophenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139538817 |
| Molecular Formula | C67H33N9 |
| Molecular Weight | 964.06 g/mol |
| Exact Mass | 963.29 |
| IUPAC Name | 5-[2,6-bis[2,7-bis(2-cyanophenyl)carbazol-9-yl]-4-cyanophenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2c(-n3c4cc(-c5ccccc5C#N)ccc4c4ccc(-c5ccccc5C#N)cc43)cc(C#N)cc2-n2c3cc(-c4ccccc4C#N)ccc3c3ccc(-c4ccccc4C#N)cc32)c1 |
| InChI | InChI=1S/C67H33N9/c68-34-41-25-42(35-69)27-52(26-41)67-65(75-61-30-44(53-13-5-1-9-48(53)37-71)17-21-57(61)58-22-18-45(31-62(58)75)54-14-6-2-10-49(54)38-72)28-43(36-70)29-66(67)76-63-32-46(55-15-7-3-11-50(55)39-73)19-23-59(63)60-24-20-47(33-64(60)76)56-16-8-4-12-51(56)40-74/h1-33H |
| InChIKey | GYEDQZCTBWOFCF-UHFFFAOYSA-N |
| XLogP | 15.32 |
| TPSA | 176.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.06 |
| LogP ≤ 5 | 15.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |