C70H43N11 — CID 147847714
2-[4-[2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzonitrile (PubChem CID 147847714) has the molecular formula C70H43N11 and a molecular weight of 1038.19 g/mol. Its IUPAC name is 2-[4-[2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzonitrile.
| Compound Name | 2-[4-[2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 147847714 |
| Molecular Formula | C70H43N11 |
| Molecular Weight | 1038.19 g/mol |
| Exact Mass | 1037.37 |
| IUPAC Name | 2-[4-[2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc(-n2c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc32)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C70H43N11/c71-44-54-33-19-20-34-55(54)51-37-40-59(58(41-51)70-79-66(49-29-15-5-16-30-49)74-67(80-70)50-31-17-6-18-32-50)81-60-42-52(68-75-62(45-21-7-1-8-22-45)72-63(76-68)46-23-9-2-10-24-46)35-38-56(60)57-39-36-53(43-61(57)81)69-77-64(47-25-11-3-12-26-47)73-65(78-69)48-27-13-4-14-28-48/h1-43H |
| InChIKey | HUFHAKZPPGGRFF-UHFFFAOYSA-N |
| XLogP | 15.88 |
| TPSA | 144.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.19 |
| LogP ≤ 5 | 15.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |