C56H33N9 — CID 137414622
5-[9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 137414622) has the molecular formula C56H33N9 and a molecular weight of 831.94 g/mol. Its IUPAC name is 5-[9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 137414622 |
| Molecular Formula | C56H33N9 |
| Molecular Weight | 831.94 g/mol |
| Exact Mass | 831.29 |
| IUPAC Name | 5-[9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2ccc3c4ccccc4n(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)c1 |
| InChI | InChI=1S/C56H33N9/c57-34-36-29-37(35-58)31-44(30-36)42-25-27-46-45-23-13-14-24-48(45)65(50(46)33-42)49-28-26-43(55-61-51(38-15-5-1-6-16-38)59-52(62-55)39-17-7-2-8-18-39)32-47(49)56-63-53(40-19-9-3-10-20-40)60-54(64-56)41-21-11-4-12-22-41/h1-33H |
| InChIKey | XAMPBCVJIBZAIB-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 129.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.94 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |