C35H26N8 — CID 137420905
2-[9-[2,4-bis(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]benzonitrile (PubChem CID 137420905) has the molecular formula C35H26N8 and a molecular weight of 558.65 g/mol. Its IUPAC name is 2-[9-[2,4-bis(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]benzonitrile.
| Compound Name | 2-[9-[2,4-bis(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 137420905 |
| Molecular Formula | C35H26N8 |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 2-[9-[2,4-bis(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]benzonitrile |
| SMILES | Cc1nc(C)nc(-c2ccc(-n3c4ccccc4c4ccc(-c5ccccc5C#N)cc43)c(-c3nc(C)nc(C)n3)c2)n1 |
| InChI | InChI=1S/C35H26N8/c1-20-37-21(2)40-34(39-20)25-14-16-32(30(17-25)35-41-22(3)38-23(4)42-35)43-31-12-8-7-11-28(31)29-15-13-24(18-33(29)43)27-10-6-5-9-26(27)19-36/h5-18H,1-4H3 |
| InChIKey | CRYDAEAMTAYHSZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 106.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |