C31H20N6 — CID 140871885
4-(4,6-dimethyl-1,3,5-triazin-2-yl)-2-[2-(2-isocyanophenyl)carbazol-9-yl]benzonitrile (PubChem CID 140871885) has the molecular formula C31H20N6 and a molecular weight of 476.54 g/mol. Its IUPAC name is 4-(4,6-dimethyl-1,3,5-triazin-2-yl)-2-[2-(2-isocyanophenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-(4,6-dimethyl-1,3,5-triazin-2-yl)-2-[2-(2-isocyanophenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 140871885 |
| Molecular Formula | C31H20N6 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 4-(4,6-dimethyl-1,3,5-triazin-2-yl)-2-[2-(2-isocyanophenyl)carbazol-9-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc2c3ccccc3n(-c3cc(-c4nc(C)nc(C)n4)ccc3C#N)c2c1 |
| InChI | InChI=1S/C31H20N6/c1-19-34-20(2)36-31(35-19)22-12-13-23(18-32)29(17-22)37-28-11-7-5-9-25(28)26-15-14-21(16-30(26)37)24-8-4-6-10-27(24)33-3/h4-17H,1-2H3 |
| InChIKey | LXPNDEUCDYFKEJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|