C26H15N7 — CID 140871836
9-[2-cyano-5-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-7-isocyanocarbazole-2-carbonitrile (PubChem CID 140871836) has the molecular formula C26H15N7 and a molecular weight of 425.46 g/mol. Its IUPAC name is 9-[2-cyano-5-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-7-isocyanocarbazole-2-carbonitrile.
| Compound Name | 9-[2-cyano-5-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-7-isocyanocarbazole-2-carbonitrile |
|---|---|
| PubChem CID | 140871836 |
| Molecular Formula | C26H15N7 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 9-[2-cyano-5-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-7-isocyanocarbazole-2-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c3ccc(C#N)cc3n(-c3cc(-c4nc(C)nc(C)n4)ccc3C#N)c2c1 |
| InChI | InChI=1S/C26H15N7/c1-15-30-16(2)32-26(31-15)18-5-6-19(14-28)23(11-18)33-24-10-17(13-27)4-8-21(24)22-9-7-20(29-3)12-25(22)33/h4-12H,1-2H3 |
| InChIKey | RTVZOGUZCSZYHH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 95.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|