C40H20F9N3 — CID 162571728
2,6-bis[3-(trifluoromethyl)carbazol-9-yl]-4-[3-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 162571728) has the molecular formula C40H20F9N3 and a molecular weight of 713.60 g/mol. Its IUPAC name is 2,6-bis[3-(trifluoromethyl)carbazol-9-yl]-4-[3-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis[3-(trifluoromethyl)carbazol-9-yl]-4-[3-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 162571728 |
| Molecular Formula | C40H20F9N3 |
| Molecular Weight | 713.60 g/mol |
| Exact Mass | 713.15 |
| IUPAC Name | 2,6-bis[3-(trifluoromethyl)carbazol-9-yl]-4-[3-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1c(-n2c3ccccc3c3cc(C(F)(F)F)ccc32)cc(-c2cccc(C(F)(F)F)c2)cc1-n1c2ccccc2c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C40H20F9N3/c41-38(42,43)24-7-5-6-22(16-24)23-17-36(51-32-10-3-1-8-27(32)29-19-25(39(44,45)46)12-14-34(29)51)31(21-50)37(18-23)52-33-11-4-2-9-28(33)30-20-26(40(47,48)49)13-15-35(30)52/h1-20H |
| InChIKey | CMXIQBKMYVKARX-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.60 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |