C41H19F9N4 — CID 162609134
4-[2-cyano-4-(trifluoromethyl)phenyl]-2,6-bis[3-(trifluoromethyl)carbazol-9-yl]benzonitrile (PubChem CID 162609134) has the molecular formula C41H19F9N4 and a molecular weight of 738.61 g/mol. Its IUPAC name is 4-[2-cyano-4-(trifluoromethyl)phenyl]-2,6-bis[3-(trifluoromethyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-[2-cyano-4-(trifluoromethyl)phenyl]-2,6-bis[3-(trifluoromethyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 162609134 |
| Molecular Formula | C41H19F9N4 |
| Molecular Weight | 738.61 g/mol |
| Exact Mass | 738.15 |
| IUPAC Name | 4-[2-cyano-4-(trifluoromethyl)phenyl]-2,6-bis[3-(trifluoromethyl)carbazol-9-yl]benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1-c1cc(-n2c3ccccc3c3cc(C(F)(F)F)ccc32)c(C#N)c(-n2c3ccccc3c3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C41H19F9N4/c42-39(43,44)24-9-12-27(23(15-24)20-51)22-16-37(53-33-7-3-1-5-28(33)30-18-25(40(45,46)47)10-13-35(30)53)32(21-52)38(17-22)54-34-8-4-2-6-29(34)31-19-26(41(48,49)50)11-14-36(31)54/h1-19H |
| InChIKey | UXHJBFBSLAYWNV-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.61 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |