C47H40F3N3 — CID 134295573
2,6-bis(3-tert-butylcarbazol-9-yl)-4-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 134295573) has the molecular formula C47H40F3N3 and a molecular weight of 703.85 g/mol. Its IUPAC name is 2,6-bis(3-tert-butylcarbazol-9-yl)-4-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis(3-tert-butylcarbazol-9-yl)-4-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 134295573 |
| Molecular Formula | C47H40F3N3 |
| Molecular Weight | 703.85 g/mol |
| Exact Mass | 703.32 |
| IUPAC Name | 2,6-bis(3-tert-butylcarbazol-9-yl)-4-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1cc(-c2cc(-n3c4ccccc4c4cc(C(C)(C)C)ccc43)c(C#N)c(-n3c4ccccc4c4cc(C(C)(C)C)ccc43)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C47H40F3N3/c1-28-20-29(22-33(21-28)47(48,49)50)30-23-43(52-39-14-10-8-12-34(39)36-25-31(45(2,3)4)16-18-41(36)52)38(27-51)44(24-30)53-40-15-11-9-13-35(40)37-26-32(46(5,6)7)17-19-42(37)53/h8-26H,1-7H3 |
| InChIKey | SABIJZWXZMHWJV-UHFFFAOYSA-N |
| XLogP | 13.34 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.85 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |