C41H19F3N6 — CID 162612245
5-[3,5-bis(3-cyanocarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 162612245) has the molecular formula C41H19F3N6 and a molecular weight of 652.64 g/mol. Its IUPAC name is 5-[3,5-bis(3-cyanocarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[3,5-bis(3-cyanocarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 162612245 |
| Molecular Formula | C41H19F3N6 |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | 5-[3,5-bis(3-cyanocarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2cc(-n3c4ccccc4c4cc(C#N)ccc43)c(C(F)(F)F)c(-n3c4ccccc4c4cc(C#N)ccc43)c2)c1 |
| InChI | InChI=1S/C41H19F3N6/c42-41(43,44)40-38(49-34-7-3-1-5-30(34)32-16-24(20-45)9-11-36(32)49)18-29(28-14-26(22-47)13-27(15-28)23-48)19-39(40)50-35-8-4-2-6-31(35)33-17-25(21-46)10-12-37(33)50/h1-19H |
| InChIKey | RLRPGKXOQMOSHO-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 105.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |