C41H25F3N4 — CID 162612235
5-[3,5-bis(2-methylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 162612235) has the molecular formula C41H25F3N4 and a molecular weight of 630.67 g/mol. Its IUPAC name is 5-[3,5-bis(2-methylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[3,5-bis(2-methylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 162612235 |
| Molecular Formula | C41H25F3N4 |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | 5-[3,5-bis(2-methylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | Cc1ccc2c3ccccc3n(-c3cc(-c4cc(C#N)cc(C#N)c4)cc(-n4c5ccccc5c5ccc(C)cc54)c3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C41H25F3N4/c1-24-11-13-32-30-7-3-5-9-34(30)47(36(32)15-24)38-20-29(28-18-26(22-45)17-27(19-28)23-46)21-39(40(38)41(42,43)44)48-35-10-6-4-8-31(35)33-14-12-25(2)16-37(33)48/h3-21H,1-2H3 |
| InChIKey | VEPRRPYUEDZPGL-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |