C47H37F6N3 — CID 134473616
4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis(2-tert-butylcarbazol-9-yl)benzonitrile (PubChem CID 134473616) has the molecular formula C47H37F6N3 and a molecular weight of 757.82 g/mol. Its IUPAC name is 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis(2-tert-butylcarbazol-9-yl)benzonitrile.
| Compound Name | 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis(2-tert-butylcarbazol-9-yl)benzonitrile |
|---|---|
| PubChem CID | 134473616 |
| Molecular Formula | C47H37F6N3 |
| Molecular Weight | 757.82 g/mol |
| Exact Mass | 757.29 |
| IUPAC Name | 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-bis(2-tert-butylcarbazol-9-yl)benzonitrile |
| SMILES | CC(C)(C)c1ccc2c3ccccc3n(-c3cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)cc(-n4c5ccccc5c5ccc(C(C)(C)C)cc54)c3C#N)c2c1 |
| InChI | InChI=1S/C47H37F6N3/c1-44(2,3)28-15-19-34-32-11-7-9-13-38(32)55(42(34)24-28)40-21-27(31-18-17-30(46(48,49)50)23-37(31)47(51,52)53)22-41(36(40)26-54)56-39-14-10-8-12-33(39)35-20-16-29(25-43(35)56)45(4,5)6/h7-25H,1-6H3 |
| InChIKey | MYNKXHFEIIIUKM-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.82 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |