C17H22N2 — CID 82499617
3-(5-tert-butyl-1,2-dimethylindol-3-yl)propanenitrile (PubChem CID 82499617) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-(5-tert-butyl-1,2-dimethylindol-3-yl)propanenitrile.
| Compound Name | 3-(5-tert-butyl-1,2-dimethylindol-3-yl)propanenitrile |
|---|---|
| PubChem CID | 82499617 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 3-(5-tert-butyl-1,2-dimethylindol-3-yl)propanenitrile |
| SMILES | Cc1c(CCC#N)c2cc(C(C)(C)C)ccc2n1C |
| InChI | InChI=1S/C17H22N2/c1-12-14(7-6-10-18)15-11-13(17(2,3)4)8-9-16(15)19(12)5/h8-9,11H,6-7H2,1-5H3 |
| InChIKey | UIIILYRDHALVFM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|