C18H27N — CID 59882822
2,5-ditert-butyl-1,3-dimethylindole (PubChem CID 59882822) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 2,5-ditert-butyl-1,3-dimethylindole.
| Compound Name | 2,5-ditert-butyl-1,3-dimethylindole |
|---|---|
| PubChem CID | 59882822 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 2,5-ditert-butyl-1,3-dimethylindole |
| SMILES | Cc1c(C(C)(C)C)n(C)c2ccc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C18H27N/c1-12-14-11-13(17(2,3)4)9-10-15(14)19(8)16(12)18(5,6)7/h9-11H,1-8H3 |
| InChIKey | RAIAETVWCFEQSJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |