About 2,6,9-tritert-butylcarbazole
2,6,9-tritert-butylcarbazole (PubChem CID 177113514) has the molecular formula C24H33N
and a molecular weight of 335.54 g/mol. Its IUPAC name is 2,6,9-tritert-butylcarbazole.
Molecular Properties
| Compound Name | 2,6,9-tritert-butylcarbazole |
| PubChem CID | 177113514 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 2,6,9-tritert-butylcarbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1ccc(C(C)(C)C)cc1n2C(C)(C)C |
| InChI | InChI=1S/C24H33N/c1-22(2,3)16-11-13-20-19(14-16)18-12-10-17(23(4,5)6)15-21(18)25(20)24(7,8)9/h10-15H,1-9H3 |
| InChIKey | OVZSLPGWXNANEF-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6,9-tritert-butylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6,9-tritert-butylcarbazole?
The IUPAC name of 2,6,9-tritert-butylcarbazole (CID 177113514) is 2,6,9-tritert-butylcarbazole.
What is the SMILES notation for 2,6,9-tritert-butylcarbazole?
The canonical SMILES for 2,6,9-tritert-butylcarbazole is CC(C)(C)c1ccc2c(c1)c1ccc(C(C)(C)C)cc1n2C(C)(C)C.
What is the InChIKey of 2,6,9-tritert-butylcarbazole?
The InChIKey is OVZSLPGWXNANEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33N/c1-22(2,3)16-11-13-20-19(14-16)18-12-10-17(23(4,5)6)15-21(18)25(20)24(7,8)9/h10-15H,1-9H3.
What are the key properties of 2,6,9-tritert-butylcarbazole?
2,6,9-tritert-butylcarbazole has a molecular weight of 335.54 g/mol, XLogP of 7.14, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6,9-tritert-butylcarbazole is sourced from PubChem (CID 177113514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).