C24H33N — CID 177113514
2,6,9-tritert-butylcarbazole (PubChem CID 177113514) has the molecular formula C24H33N and a molecular weight of 335.54 g/mol. Its IUPAC name is 2,6,9-tritert-butylcarbazole.
| Compound Name | 2,6,9-tritert-butylcarbazole |
|---|---|
| PubChem CID | 177113514 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 2,6,9-tritert-butylcarbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1ccc(C(C)(C)C)cc1n2C(C)(C)C |
| InChI | InChI=1S/C24H33N/c1-22(2,3)16-11-13-20-19(14-16)18-12-10-17(23(4,5)6)15-21(18)25(20)24(7,8)9/h10-15H,1-9H3 |
| InChIKey | OVZSLPGWXNANEF-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |