C40H46N2 — CID 171595251
6,11,18,23-tetratert-butyl-2,14-diazaheptacyclo[12.10.1.12,9.03,8.015,20.021,25.013,26]hexacosa-1(24),3(8),4,6,9(26),10,12,15(20),16,18,21(25),22-dodecaene (PubChem CID 171595251) has the molecular formula C40H46N2 and a molecular weight of 554.82 g/mol. Its IUPAC name is 6,11,18,23-tetratert-butyl-2,14-diazaheptacyclo[12.10.1.12,9.03,8.015,20.021,25.013,26]hexacosa-1(24),3(8),4,6,9(26),10,12,15(20),16,18,21(25),22-dodecaene.
| Compound Name | 6,11,18,23-tetratert-butyl-2,14-diazaheptacyclo[12.10.1.12,9.03,8.015,20.021,25.013,26]hexacosa-1(24),3(8),4,6,9(26),10,12,15(20),16,18,21(25),22-dodecaene |
|---|---|
| PubChem CID | 171595251 |
| Molecular Formula | C40H46N2 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.37 |
| IUPAC Name | 6,11,18,23-tetratert-butyl-2,14-diazaheptacyclo[12.10.1.12,9.03,8.015,20.021,25.013,26]hexacosa-1(24),3(8),4,6,9(26),10,12,15(20),16,18,21(25),22-dodecaene |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)cc3c1n2c1cc(C(C)(C)C)cc2c4cc(C(C)(C)C)ccc4n3c21 |
| InChI | InChI=1S/C40H46N2/c1-37(2,3)23-13-15-31-27(17-23)29-19-25(39(7,8)9)21-33-35(29)41(31)34-22-26(40(10,11)12)20-30-28-18-24(38(4,5)6)14-16-32(28)42(33)36(30)34/h13-22H,1-12H3 |
| InChIKey | KHBONBXSCJMCFF-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 8.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|