C26H27N — CID 102489233
5,10-ditert-butyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene (PubChem CID 102489233) has the molecular formula C26H27N and a molecular weight of 353.51 g/mol. Its IUPAC name is 5,10-ditert-butyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene.
| Compound Name | 5,10-ditert-butyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
|---|---|
| PubChem CID | 102489233 |
| Molecular Formula | C26H27N |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 5,10-ditert-butyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)cc3c4ccccc4n2c31 |
| InChI | InChI=1S/C26H27N/c1-25(2,3)16-11-12-23-19(13-16)21-15-17(26(4,5)6)14-20-18-9-7-8-10-22(18)27(23)24(20)21/h7-15H,1-6H3 |
| InChIKey | CEIVNBSAFOBVOH-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |