C44H50 — CID 123877985
2,7-ditert-butyl-9-(2,7-ditert-butylphenanthren-9-yl)phenanthrene (PubChem CID 123877985) has the molecular formula C44H50 and a molecular weight of 578.88 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-(2,7-ditert-butylphenanthren-9-yl)phenanthrene.
| Compound Name | 2,7-ditert-butyl-9-(2,7-ditert-butylphenanthren-9-yl)phenanthrene |
|---|---|
| PubChem CID | 123877985 |
| Molecular Formula | C44H50 |
| Molecular Weight | 578.88 g/mol |
| Exact Mass | 578.39 |
| IUPAC Name | 2,7-ditert-butyl-9-(2,7-ditert-butylphenanthren-9-yl)phenanthrene |
| SMILES | CC(C)(C)c1ccc2c(c1)cc(-c1cc3cc(C(C)(C)C)ccc3c3ccc(C(C)(C)C)cc13)c1cc(C(C)(C)C)ccc12 |
| InChI | InChI=1S/C44H50/c1-41(2,3)29-13-17-33-27(21-29)23-37(39-25-31(43(7,8)9)15-19-35(33)39)38-24-28-22-30(42(4,5)6)14-18-34(28)36-20-16-32(26-40(36)38)44(10,11)12/h13-26H,1-12H3 |
| InChIKey | YOBKCFRMIZWYKT-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.88 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|