C18H25BO2 — CID 58068101
(3,7-ditert-butylnaphthalen-1-yl)boronic acid (PubChem CID 58068101) has the molecular formula C18H25BO2 and a molecular weight of 284.21 g/mol. Its IUPAC name is (3,7-ditert-butylnaphthalen-1-yl)boronic acid.
| Compound Name | (3,7-ditert-butylnaphthalen-1-yl)boronic acid |
|---|---|
| PubChem CID | 58068101 |
| Molecular Formula | C18H25BO2 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (3,7-ditert-butylnaphthalen-1-yl)boronic acid |
| SMILES | CC(C)(C)c1cc(B(O)O)c2cc(C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C18H25BO2/c1-17(2,3)13-8-7-12-9-14(18(4,5)6)11-16(19(20)21)15(12)10-13/h7-11,20-21H,1-6H3 |
| InChIKey | NQPWTTVNVKFHFS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|