(3,7-ditert-butylnaphthalen-1-yl)boronic acid

C18H25BO2 — CID 58068101

IUPAC(3,7-ditert-butylnaphthalen-1-yl)boronic acid
SMILESCC(C)(C)c1cc(B(O)O)c2cc(C(C)(C)C)ccc2c1
InChIInChI=1S/C18H25BO2/c1-17(2,3)13-8-7-12-9-14(18(4,5)6)11-16(19(20)21)15(12)10-13/h7-11,20-21H,1-6H3
InChIKeyNQPWTTVNVKFHFS-UHFFFAOYSA-N
MW284.21 g/mol
LogP3.11
Rot. Bonds1

About (3,7-ditert-butylnaphthalen-1-yl)boronic acid

(3,7-ditert-butylnaphthalen-1-yl)boronic acid (PubChem CID 58068101) has the molecular formula C18H25BO2 and a molecular weight of 284.21 g/mol. Its IUPAC name is (3,7-ditert-butylnaphthalen-1-yl)boronic acid.

Molecular Properties

Compound Name(3,7-ditert-butylnaphthalen-1-yl)boronic acid
PubChem CID58068101
Molecular FormulaC18H25BO2
Molecular Weight284.21 g/mol
Exact Mass284.19
IUPAC Name(3,7-ditert-butylnaphthalen-1-yl)boronic acid
SMILESCC(C)(C)c1cc(B(O)O)c2cc(C(C)(C)C)ccc2c1
InChIInChI=1S/C18H25BO2/c1-17(2,3)13-8-7-12-9-14(18(4,5)6)11-16(19(20)21)15(12)10-13/h7-11,20-21H,1-6H3
InChIKeyNQPWTTVNVKFHFS-UHFFFAOYSA-N
XLogP3.11
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.21
LogP ≤ 53.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3,7-ditert-butylnaphthalen-1-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,7-ditert-butylnaphthalen-1-yl)boronic acid?
The IUPAC name of (3,7-ditert-butylnaphthalen-1-yl)boronic acid (CID 58068101) is (3,7-ditert-butylnaphthalen-1-yl)boronic acid.
What is the SMILES notation for (3,7-ditert-butylnaphthalen-1-yl)boronic acid?
The canonical SMILES for (3,7-ditert-butylnaphthalen-1-yl)boronic acid is CC(C)(C)c1cc(B(O)O)c2cc(C(C)(C)C)ccc2c1.
What is the InChIKey of (3,7-ditert-butylnaphthalen-1-yl)boronic acid?
The InChIKey is NQPWTTVNVKFHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25BO2/c1-17(2,3)13-8-7-12-9-14(18(4,5)6)11-16(19(20)21)15(12)10-13/h7-11,20-21H,1-6H3.
What are the key properties of (3,7-ditert-butylnaphthalen-1-yl)boronic acid?
(3,7-ditert-butylnaphthalen-1-yl)boronic acid has a molecular weight of 284.21 g/mol, XLogP of 3.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,7-ditert-butylnaphthalen-1-yl)boronic acid is sourced from PubChem (CID 58068101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).