C22H25Br — CID 171571905
1-bromo-3,6-ditert-butylanthracene (PubChem CID 171571905) has the molecular formula C22H25Br and a molecular weight of 369.35 g/mol. Its IUPAC name is 1-bromo-3,6-ditert-butylanthracene.
| Compound Name | 1-bromo-3,6-ditert-butylanthracene |
|---|---|
| PubChem CID | 171571905 |
| Molecular Formula | C22H25Br |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-bromo-3,6-ditert-butylanthracene |
| SMILES | CC(C)(C)c1ccc2cc3c(Br)cc(C(C)(C)C)cc3cc2c1 |
| InChI | InChI=1S/C22H25Br/c1-21(2,3)17-8-7-14-12-19-16(9-15(14)10-17)11-18(13-20(19)23)22(4,5)6/h7-13H,1-6H3 |
| InChIKey | HWBYMQRHLJHIMR-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|