C38H32Br2 — CID 132819532
6-bromo-7-(2-bromophenyl)-14,21-ditert-butylhexacyclo[10.10.2.02,11.04,9.016,24.019,23]tetracosa-1(23),2(11),3,5,7,9,12(24),13,15,17,19,21-dodecaene (PubChem CID 132819532) has the molecular formula C38H32Br2 and a molecular weight of 648.48 g/mol. Its IUPAC name is 6-bromo-7-(2-bromophenyl)-14,21-ditert-butylhexacyclo[10.10.2.02,11.04,9.016,24.019,23]tetracosa-1(23),2(11),3,5,7,9,12(24),13,15,17,19,21-dodecaene.
| Compound Name | 6-bromo-7-(2-bromophenyl)-14,21-ditert-butylhexacyclo[10.10.2.02,11.04,9.016,24.019,23]tetracosa-1(23),2(11),3,5,7,9,12(24),13,15,17,19,21-dodecaene |
|---|---|
| PubChem CID | 132819532 |
| Molecular Formula | C38H32Br2 |
| Molecular Weight | 648.48 g/mol |
| Exact Mass | 646.09 |
| IUPAC Name | 6-bromo-7-(2-bromophenyl)-14,21-ditert-butylhexacyclo[10.10.2.02,11.04,9.016,24.019,23]tetracosa-1(23),2(11),3,5,7,9,12(24),13,15,17,19,21-dodecaene |
| SMILES | CC(C)(C)c1cc2ccc3cc(C(C)(C)C)cc4c5cc6cc(-c7ccccc7Br)c(Br)cc6cc5c(c1)c2c34 |
| InChI | InChI=1S/C38H32Br2/c1-37(2,3)25-13-21-11-12-22-14-26(38(4,5)6)20-32-29-16-24-18-34(40)30(27-9-7-8-10-33(27)39)17-23(24)15-28(29)31(19-25)35(21)36(22)32/h7-20H,1-6H3 |
| InChIKey | SVUPDIUPYGJANC-UHFFFAOYSA-N |
| XLogP | 12.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.48 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|