C39H34O — CID 164672110
9,16-ditert-butyl-3,5-diphenylpentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1(18),2,5,7(19),8,10,12,14,16-nonaen-4-one (PubChem CID 164672110) has the molecular formula C39H34O and a molecular weight of 518.70 g/mol. Its IUPAC name is 9,16-ditert-butyl-3,5-diphenylpentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1(18),2,5,7(19),8,10,12,14,16-nonaen-4-one.
| Compound Name | 9,16-ditert-butyl-3,5-diphenylpentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1(18),2,5,7(19),8,10,12,14,16-nonaen-4-one |
|---|---|
| PubChem CID | 164672110 |
| Molecular Formula | C39H34O |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | 9,16-ditert-butyl-3,5-diphenylpentacyclo[9.6.2.02,6.07,19.014,18]nonadeca-1(18),2,5,7(19),8,10,12,14,16-nonaen-4-one |
| SMILES | CC(C)(C)c1cc2ccc3cc(C(C)(C)C)cc4c5c(-c6ccccc6)c(=O)c(-c6ccccc6)c5c(c1)c2c34 |
| InChI | InChI=1S/C39H34O/c1-38(2,3)27-19-25-17-18-26-20-28(39(4,5)6)22-30-32(26)31(25)29(21-27)35-33(23-13-9-7-10-14-23)37(40)34(36(30)35)24-15-11-8-12-16-24/h7-22H,1-6H3 |
| InChIKey | XFBRKGWUXXXVAV-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|