C52H42O2 — CID 102096706
9,19-ditert-butyl-4,5,14,15-tetraphenyl-3,13-dioxahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene (PubChem CID 102096706) has the molecular formula C52H42O2 and a molecular weight of 698.91 g/mol. Its IUPAC name is 9,19-ditert-butyl-4,5,14,15-tetraphenyl-3,13-dioxahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene.
| Compound Name | 9,19-ditert-butyl-4,5,14,15-tetraphenyl-3,13-dioxahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene |
|---|---|
| PubChem CID | 102096706 |
| Molecular Formula | C52H42O2 |
| Molecular Weight | 698.91 g/mol |
| Exact Mass | 698.32 |
| IUPAC Name | 9,19-ditert-butyl-4,5,14,15-tetraphenyl-3,13-dioxahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene |
| SMILES | CC(C)(C)c1cc2c3oc(-c4ccccc4)c(-c4ccccc4)c3c3cc(C(C)(C)C)cc4c5oc(-c6ccccc6)c(-c6ccccc6)c5c(c1)c2c43 |
| InChI | InChI=1S/C52H42O2/c1-51(2,3)35-27-37-43-39(29-35)49-46(42(32-21-13-8-14-22-32)48(53-49)34-25-17-10-18-26-34)38-28-36(52(4,5)6)30-40(44(38)43)50-45(37)41(31-19-11-7-12-20-31)47(54-50)33-23-15-9-16-24-33/h7-30H,1-6H3 |
| InChIKey | NPXXHMMSWDHSTR-UHFFFAOYSA-N |
| XLogP | 15.34 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.91 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|