C52H44O2 — CID 132819533
methyl 2-(14,21-ditert-butyl-3,10-diphenyl-6-hexacyclo[10.10.2.02,11.04,9.016,24.019,23]tetracosa-1(23),2,4(9),5,7,10,12(24),13,15,17,19,21-dodecaenyl)benzoate (PubChem CID 132819533) has the molecular formula C52H44O2 and a molecular weight of 700.92 g/mol. Its IUPAC name is methyl 2-(14,21-ditert-butyl-3,10-diphenyl-6-hexacyclo[10.10.2.02,11.04,9.016,24.019,23]tetracosa-1(23),2,4(9),5,7,10,12(24),13,15,17,19,21-dodecaenyl)benzoate.
| Compound Name | methyl 2-(14,21-ditert-butyl-3,10-diphenyl-6-hexacyclo[10.10.2.02,11.04,9.016,24.019,23]tetracosa-1(23),2,4(9),5,7,10,12(24),13,15,17,19,21-dodecaenyl)benzoate |
|---|---|
| PubChem CID | 132819533 |
| Molecular Formula | C52H44O2 |
| Molecular Weight | 700.92 g/mol |
| Exact Mass | 700.33 |
| IUPAC Name | methyl 2-(14,21-ditert-butyl-3,10-diphenyl-6-hexacyclo[10.10.2.02,11.04,9.016,24.019,23]tetracosa-1(23),2,4(9),5,7,10,12(24),13,15,17,19,21-dodecaenyl)benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc2c(-c3ccccc3)c3c4cc(C(C)(C)C)cc5ccc6cc(C(C)(C)C)cc(c3c(-c3ccccc3)c2c1)c6c54 |
| InChI | InChI=1S/C52H44O2/c1-51(2,3)36-26-34-22-23-35-27-37(52(4,5)6)30-43-47(35)46(34)42(29-36)48-44(31-16-10-8-11-17-31)39-25-24-33(38-20-14-15-21-40(38)50(53)54-7)28-41(39)45(49(43)48)32-18-12-9-13-19-32/h8-30H,1-7H3 |
| InChIKey | GEGZVKCSNWAFJM-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.92 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|