C46H38 — CID 140865930
1-(4-tert-butylphenyl)-2,3,4,5,6-pentakis-phenylbenzene (PubChem CID 140865930) has the molecular formula C46H38 and a molecular weight of 590.81 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2,3,4,5,6-pentakis-phenylbenzene.
| Compound Name | 1-(4-tert-butylphenyl)-2,3,4,5,6-pentakis-phenylbenzene |
|---|---|
| PubChem CID | 140865930 |
| Molecular Formula | C46H38 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2,3,4,5,6-pentakis-phenylbenzene |
| SMILES | CC(C)(C)c1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C46H38/c1-46(2,3)39-31-29-38(30-32-39)45-43(36-25-15-7-16-26-36)41(34-21-11-5-12-22-34)40(33-19-9-4-10-20-33)42(35-23-13-6-14-24-35)44(45)37-27-17-8-18-28-37/h4-32H,1-3H3 |
| InChIKey | KRTLHGLYMRVTQG-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |