About 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride
1-tert-butyl-4-phenylbenzene;sulfuryl dichloride (PubChem CID 174793677) has the molecular formula C16H18Cl2O2S
and a molecular weight of 345.29 g/mol. Its IUPAC name is 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride.
Molecular Properties
| Compound Name | 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride |
| PubChem CID | 174793677 |
| Molecular Formula | C16H18Cl2O2S |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride |
| SMILES | CC(C)(C)c1ccc(-c2ccccc2)cc1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C16H18.Cl2O2S/c1-16(2,3)15-11-9-14(10-12-15)13-7-5-4-6-8-13;1-5(2,3)4/h4-12H,1-3H3; |
| InChIKey | PHWVARKOMYIQCM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride?
The IUPAC name of 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride (CID 174793677) is 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride.
What is the SMILES notation for 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride?
The canonical SMILES for 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride is CC(C)(C)c1ccc(-c2ccccc2)cc1.O=S(=O)(Cl)Cl.
What is the InChIKey of 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride?
The InChIKey is PHWVARKOMYIQCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.Cl2O2S/c1-16(2,3)15-11-9-14(10-12-15)13-7-5-4-6-8-13;1-5(2,3)4/h4-12H,1-3H3;.
What are the key properties of 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride?
1-tert-butyl-4-phenylbenzene;sulfuryl dichloride has a molecular weight of 345.29 g/mol, XLogP of 5.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-phenylbenzene;sulfuryl dichloride is sourced from PubChem (CID 174793677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).