C23H25N — CID 70891344
N-(4-tert-butylphenyl)-N-methyl-4-phenylaniline (PubChem CID 70891344) has the molecular formula C23H25N and a molecular weight of 315.46 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-methyl-4-phenylaniline.
| Compound Name | N-(4-tert-butylphenyl)-N-methyl-4-phenylaniline |
|---|---|
| PubChem CID | 70891344 |
| Molecular Formula | C23H25N |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-methyl-4-phenylaniline |
| SMILES | CN(c1ccc(-c2ccccc2)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H25N/c1-23(2,3)20-12-16-22(17-13-20)24(4)21-14-10-19(11-15-21)18-8-6-5-7-9-18/h5-17H,1-4H3 |
| InChIKey | UOXCCLKXFDFEGX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |