About sulfuryl dichloride;tritylbenzene
sulfuryl dichloride;tritylbenzene (PubChem CID 174476389) has the molecular formula C25H20Cl2O2S
and a molecular weight of 455.41 g/mol. Its IUPAC name is sulfuryl dichloride;tritylbenzene.
Molecular Properties
| Compound Name | sulfuryl dichloride;tritylbenzene |
| PubChem CID | 174476389 |
| Molecular Formula | C25H20Cl2O2S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | sulfuryl dichloride;tritylbenzene |
| SMILES | O=S(=O)(Cl)Cl.c1ccc(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20.Cl2O2S/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-5(2,3)4/h1-20H; |
| InChIKey | IQMJGLUJFZADKA-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze sulfuryl dichloride;tritylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuryl dichloride;tritylbenzene?
The IUPAC name of sulfuryl dichloride;tritylbenzene (CID 174476389) is sulfuryl dichloride;tritylbenzene.
What is the SMILES notation for sulfuryl dichloride;tritylbenzene?
The canonical SMILES for sulfuryl dichloride;tritylbenzene is O=S(=O)(Cl)Cl.c1ccc(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of sulfuryl dichloride;tritylbenzene?
The InChIKey is IQMJGLUJFZADKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20.Cl2O2S/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-5(2,3)4/h1-20H;.
What are the key properties of sulfuryl dichloride;tritylbenzene?
sulfuryl dichloride;tritylbenzene has a molecular weight of 455.41 g/mol, XLogP of 6.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuryl dichloride;tritylbenzene is sourced from PubChem (CID 174476389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).