About tert-butylbenzene;sulfuric acid;hydrochloride
tert-butylbenzene;sulfuric acid;hydrochloride (PubChem CID 175109933) has the molecular formula C10H17ClO4S
and a molecular weight of 268.76 g/mol. Its IUPAC name is tert-butylbenzene;sulfuric acid;hydrochloride.
Molecular Properties
| Compound Name | tert-butylbenzene;sulfuric acid;hydrochloride |
| PubChem CID | 175109933 |
| Molecular Formula | C10H17ClO4S |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | tert-butylbenzene;sulfuric acid;hydrochloride |
| SMILES | CC(C)(C)c1ccccc1.Cl.O=S(=O)(O)O |
| InChI | InChI=1S/C10H14.ClH.H2O4S/c1-10(2,3)9-7-5-4-6-8-9;;1-5(2,3)4/h4-8H,1-3H3;1H;(H2,1,2,3,4) |
| InChIKey | WVICLQAZTFTBQH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butylbenzene;sulfuric acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;sulfuric acid;hydrochloride?
The IUPAC name of tert-butylbenzene;sulfuric acid;hydrochloride (CID 175109933) is tert-butylbenzene;sulfuric acid;hydrochloride.
What is the SMILES notation for tert-butylbenzene;sulfuric acid;hydrochloride?
The canonical SMILES for tert-butylbenzene;sulfuric acid;hydrochloride is CC(C)(C)c1ccccc1.Cl.O=S(=O)(O)O.
What is the InChIKey of tert-butylbenzene;sulfuric acid;hydrochloride?
The InChIKey is WVICLQAZTFTBQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.ClH.H2O4S/c1-10(2,3)9-7-5-4-6-8-9;;1-5(2,3)4/h4-8H,1-3H3;1H;(H2,1,2,3,4).
What are the key properties of tert-butylbenzene;sulfuric acid;hydrochloride?
tert-butylbenzene;sulfuric acid;hydrochloride has a molecular weight of 268.76 g/mol, XLogP of 2.75, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;sulfuric acid;hydrochloride is sourced from PubChem (CID 175109933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).