About hydrazine;sulfuric acid;trifluoromethylbenzene
hydrazine;sulfuric acid;trifluoromethylbenzene (PubChem CID 174887305) has the molecular formula C7H11F3N2O4S
and a molecular weight of 276.24 g/mol. Its IUPAC name is hydrazine;sulfuric acid;trifluoromethylbenzene.
Molecular Properties
| Compound Name | hydrazine;sulfuric acid;trifluoromethylbenzene |
| PubChem CID | 174887305 |
| Molecular Formula | C7H11F3N2O4S |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | hydrazine;sulfuric acid;trifluoromethylbenzene |
| SMILES | FC(F)(F)c1ccccc1.NN.O=S(=O)(O)O |
| InChI | InChI=1S/C7H5F3.H4N2.H2O4S/c8-7(9,10)6-4-2-1-3-5-6;1-2;1-5(2,3)4/h1-5H;1-2H2;(H2,1,2,3,4) |
| InChIKey | GDVCSECEMMAUCY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;sulfuric acid;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;sulfuric acid;trifluoromethylbenzene?
The IUPAC name of hydrazine;sulfuric acid;trifluoromethylbenzene (CID 174887305) is hydrazine;sulfuric acid;trifluoromethylbenzene.
What is the SMILES notation for hydrazine;sulfuric acid;trifluoromethylbenzene?
The canonical SMILES for hydrazine;sulfuric acid;trifluoromethylbenzene is FC(F)(F)c1ccccc1.NN.O=S(=O)(O)O.
What is the InChIKey of hydrazine;sulfuric acid;trifluoromethylbenzene?
The InChIKey is GDVCSECEMMAUCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3.H4N2.H2O4S/c8-7(9,10)6-4-2-1-3-5-6;1-2;1-5(2,3)4/h1-5H;1-2H2;(H2,1,2,3,4).
What are the key properties of hydrazine;sulfuric acid;trifluoromethylbenzene?
hydrazine;sulfuric acid;trifluoromethylbenzene has a molecular weight of 276.24 g/mol, XLogP of 0.87, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;sulfuric acid;trifluoromethylbenzene is sourced from PubChem (CID 174887305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).