About sulfuric acid;3-(trifluoromethyl)aniline
sulfuric acid;3-(trifluoromethyl)aniline (PubChem CID 171926683) has the molecular formula C7H8F3NO4S
and a molecular weight of 259.20 g/mol. Its IUPAC name is sulfuric acid;3-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | sulfuric acid;3-(trifluoromethyl)aniline |
| PubChem CID | 171926683 |
| Molecular Formula | C7H8F3NO4S |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | sulfuric acid;3-(trifluoromethyl)aniline |
| SMILES | Nc1cccc(C(F)(F)F)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H6F3N.H2O4S/c8-7(9,10)5-2-1-3-6(11)4-5;1-5(2,3)4/h1-4H,11H2;(H2,1,2,3,4) |
| InChIKey | FGFBTMXXZOTTPK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfuric acid;3-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuric acid;3-(trifluoromethyl)aniline?
The IUPAC name of sulfuric acid;3-(trifluoromethyl)aniline (CID 171926683) is sulfuric acid;3-(trifluoromethyl)aniline.
What is the SMILES notation for sulfuric acid;3-(trifluoromethyl)aniline?
The canonical SMILES for sulfuric acid;3-(trifluoromethyl)aniline is Nc1cccc(C(F)(F)F)c1.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;3-(trifluoromethyl)aniline?
The InChIKey is FGFBTMXXZOTTPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N.H2O4S/c8-7(9,10)5-2-1-3-6(11)4-5;1-5(2,3)4/h1-4H,11H2;(H2,1,2,3,4).
What are the key properties of sulfuric acid;3-(trifluoromethyl)aniline?
sulfuric acid;3-(trifluoromethyl)aniline has a molecular weight of 259.20 g/mol, XLogP of 1.63, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;3-(trifluoromethyl)aniline is sourced from PubChem (CID 171926683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).