C18H14F6N2O4 — CID 87669692
3-(trifluoromethyl)aniline;(E)-2-[3-(trifluoromethyl)anilino]but-2-enedioic acid (PubChem CID 87669692) has the molecular formula C18H14F6N2O4 and a molecular weight of 436.31 g/mol. Its IUPAC name is 3-(trifluoromethyl)aniline;(E)-2-[3-(trifluoromethyl)anilino]but-2-enedioic acid.
| Compound Name | 3-(trifluoromethyl)aniline;(E)-2-[3-(trifluoromethyl)anilino]but-2-enedioic acid |
|---|---|
| PubChem CID | 87669692 |
| Molecular Formula | C18H14F6N2O4 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 3-(trifluoromethyl)aniline;(E)-2-[3-(trifluoromethyl)anilino]but-2-enedioic acid |
| SMILES | Nc1cccc(C(F)(F)F)c1.O=C(O)/C=C(/Nc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C11H8F3NO4.C7H6F3N/c12-11(13,14)6-2-1-3-7(4-6)15-8(10(18)19)5-9(16)17;8-7(9,10)5-2-1-3-6(11)4-5/h1-5,15H,(H,16,17)(H,18,19);1-4H,11H2/b8-5+; |
| InChIKey | UZDNLZAFVVURTG-HAAWTFQLSA-N |
| XLogP | 4.46 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|