C22H16F3NO — CID 53385273
(Z)-1,3-diphenyl-3-[3-(trifluoromethyl)anilino]prop-2-en-1-one (PubChem CID 53385273) has the molecular formula C22H16F3NO and a molecular weight of 367.37 g/mol. Its IUPAC name is (Z)-1,3-diphenyl-3-[3-(trifluoromethyl)anilino]prop-2-en-1-one.
| Compound Name | (Z)-1,3-diphenyl-3-[3-(trifluoromethyl)anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 53385273 |
| Molecular Formula | C22H16F3NO |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (Z)-1,3-diphenyl-3-[3-(trifluoromethyl)anilino]prop-2-en-1-one |
| SMILES | O=C(/C=C(\Nc1cccc(C(F)(F)F)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H16F3NO/c23-22(24,25)18-12-7-13-19(14-18)26-20(16-8-3-1-4-9-16)15-21(27)17-10-5-2-6-11-17/h1-15,26H/b20-15- |
| InChIKey | UUKDAMRFLXJQRF-HKWRFOASSA-N |
| XLogP | 6.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|