C11H6Cl2F3NO3 — CID 5386948
(E)-2,3-dichloro-4-oxo-4-[3-(trifluoromethyl)anilino]but-2-enoic acid (PubChem CID 5386948) has the molecular formula C11H6Cl2F3NO3 and a molecular weight of 328.07 g/mol. Its IUPAC name is (E)-2,3-dichloro-4-oxo-4-[3-(trifluoromethyl)anilino]but-2-enoic acid.
| Compound Name | (E)-2,3-dichloro-4-oxo-4-[3-(trifluoromethyl)anilino]but-2-enoic acid |
|---|---|
| PubChem CID | 5386948 |
| Molecular Formula | C11H6Cl2F3NO3 |
| Molecular Weight | 328.07 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | (E)-2,3-dichloro-4-oxo-4-[3-(trifluoromethyl)anilino]but-2-enoic acid |
| SMILES | O=C(O)/C(Cl)=C(\Cl)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6Cl2F3NO3/c12-7(8(13)10(19)20)9(18)17-6-3-1-2-5(4-6)11(14,15)16/h1-4H,(H,17,18)(H,19,20)/b8-7+ |
| InChIKey | LULYSGMUJIBQIT-BQYQJAHWSA-N |
| XLogP | 3.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.07 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|