C13H15F3N2O4 — CID 108501333
N',N'-bis(2-hydroxyethyl)-N-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 108501333) has the molecular formula C13H15F3N2O4 and a molecular weight of 320.27 g/mol. Its IUPAC name is N',N'-bis(2-hydroxyethyl)-N-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N',N'-bis(2-hydroxyethyl)-N-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 108501333 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N',N'-bis(2-hydroxyethyl)-N-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C13H15F3N2O4/c14-13(15,16)9-2-1-3-10(8-9)17-11(21)12(22)18(4-6-19)5-7-20/h1-3,8,19-20H,4-7H2,(H,17,21) |
| InChIKey | VXIUUYCYRUKTSW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|