C7H6F3KNO2S — CID 70262336
CID 70262336 (PubChem CID 70262336) has the molecular formula C7H6F3KNO2S and a molecular weight of 264.29 g/mol.
| Compound Name | CID 70262336 |
|---|---|
| PubChem CID | 70262336 |
| Molecular Formula | C7H6F3KNO2S |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | — |
| SMILES | NS(=O)(=O)c1cccc(C(F)(F)F)c1.[K] |
| InChI | InChI=1S/C7H6F3NO2S.K/c8-7(9,10)5-2-1-3-6(4-5)14(11,12)13;/h1-4H,(H2,11,12,13); |
| InChIKey | GVIZASDWLWHDBQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |