C7H5F3KNO2S — CID 131721326
potassium [3-(trifluoromethyl)phenyl]sulfonylazanide (PubChem CID 131721326) has the molecular formula C7H5F3KNO2S and a molecular weight of 263.28 g/mol. Its IUPAC name is potassium [3-(trifluoromethyl)phenyl]sulfonylazanide.
| Compound Name | potassium [3-(trifluoromethyl)phenyl]sulfonylazanide |
|---|---|
| PubChem CID | 131721326 |
| Molecular Formula | C7H5F3KNO2S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | potassium [3-(trifluoromethyl)phenyl]sulfonylazanide |
| SMILES | [K+].[NH-]S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C7H5F3NO2S.K/c8-7(9,10)5-2-1-3-6(4-5)14(11,12)13;/h1-4H,(H-,11,12,13);/q-1;+1 |
| InChIKey | PONQKDRHPAZRET-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 57.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |