C12H13F3O3S — CID 67054918
1-(3-methoxycyclobutyl)sulfonyl-3-(trifluoromethyl)benzene (PubChem CID 67054918) has the molecular formula C12H13F3O3S and a molecular weight of 294.29 g/mol. Its IUPAC name is 1-(3-methoxycyclobutyl)sulfonyl-3-(trifluoromethyl)benzene.
| Compound Name | 1-(3-methoxycyclobutyl)sulfonyl-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 67054918 |
| Molecular Formula | C12H13F3O3S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1-(3-methoxycyclobutyl)sulfonyl-3-(trifluoromethyl)benzene |
| SMILES | COC1CC(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H13F3O3S/c1-18-9-6-11(7-9)19(16,17)10-4-2-3-8(5-10)12(13,14)15/h2-5,9,11H,6-7H2,1H3 |
| InChIKey | KDRVSZCILPMWEB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |