C18H15ClF3NO3S — CID 162197775
2-(5-chloro-3-pyridinyl)-1-[3-[3-(trifluoromethyl)phenyl]sulfonylcyclobutyl]ethanone (PubChem CID 162197775) has the molecular formula C18H15ClF3NO3S and a molecular weight of 417.84 g/mol. Its IUPAC name is 2-(5-chloro-3-pyridinyl)-1-[3-[3-(trifluoromethyl)phenyl]sulfonylcyclobutyl]ethanone.
| Compound Name | 2-(5-chloro-3-pyridinyl)-1-[3-[3-(trifluoromethyl)phenyl]sulfonylcyclobutyl]ethanone |
|---|---|
| PubChem CID | 162197775 |
| Molecular Formula | C18H15ClF3NO3S |
| Molecular Weight | 417.84 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 2-(5-chloro-3-pyridinyl)-1-[3-[3-(trifluoromethyl)phenyl]sulfonylcyclobutyl]ethanone |
| SMILES | O=C(Cc1cncc(Cl)c1)C1CC(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H15ClF3NO3S/c19-14-4-11(9-23-10-14)5-17(24)12-6-16(7-12)27(25,26)15-3-1-2-13(8-15)18(20,21)22/h1-4,8-10,12,16H,5-7H2 |
| InChIKey | ZREGRJRAPLAINZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.84 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |