C21H28F3NO3S — CID 158422763
N-cyclohexyl-4-[3-[3-(trifluoromethyl)phenyl]sulfonylcyclobutyl]butanamide (PubChem CID 158422763) has the molecular formula C21H28F3NO3S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-cyclohexyl-4-[3-[3-(trifluoromethyl)phenyl]sulfonylcyclobutyl]butanamide.
| Compound Name | N-cyclohexyl-4-[3-[3-(trifluoromethyl)phenyl]sulfonylcyclobutyl]butanamide |
|---|---|
| PubChem CID | 158422763 |
| Molecular Formula | C21H28F3NO3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-cyclohexyl-4-[3-[3-(trifluoromethyl)phenyl]sulfonylcyclobutyl]butanamide |
| SMILES | O=C(CCCC1CC(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1)NC1CCCCC1 |
| InChI | InChI=1S/C21H28F3NO3S/c22-21(23,24)16-7-5-10-18(14-16)29(27,28)19-12-15(13-19)6-4-11-20(26)25-17-8-2-1-3-9-17/h5,7,10,14-15,17,19H,1-4,6,8-9,11-13H2,(H,25,26) |
| InChIKey | HARLUYVSBLJGSS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |